C21H22N2O4 — CID 18267761
[3-(2-cyanoanilino)-3-oxopropyl] 3-(2,5-dimethylphenoxy)propanoate (PubChem CID 18267761) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is [3-(2-cyanoanilino)-3-oxopropyl] 3-(2,5-dimethylphenoxy)propanoate.
| Compound Name | [3-(2-cyanoanilino)-3-oxopropyl] 3-(2,5-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 18267761 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [3-(2-cyanoanilino)-3-oxopropyl] 3-(2,5-dimethylphenoxy)propanoate |
| SMILES | Cc1ccc(C)c(OCCC(=O)OCCC(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-15-7-8-16(2)19(13-15)26-12-10-21(25)27-11-9-20(24)23-18-6-4-3-5-17(18)14-22/h3-8,13H,9-12H2,1-2H3,(H,23,24) |
| InChIKey | VXVMGTXWBJIYCJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |