C17H19N3O6S2 — CID 18267826
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 18267826) has the molecular formula C17H19N3O6S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 18267826 |
| Molecular Formula | C17H19N3O6S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)OCC(=O)NNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H19N3O6S2/c1-12-4-6-13(7-5-12)28(24,25)18-9-8-16(22)26-11-15(21)19-20-17(23)14-3-2-10-27-14/h2-7,10,18H,8-9,11H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | QVXFFYPEGUKNTL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|