C22H24N4O6 — CID 18268466
[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(diethylamino)-5-nitrobenzoate (PubChem CID 18268466) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(diethylamino)-5-nitrobenzoate.
| Compound Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(diethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 18268466 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(diethylamino)-5-nitrobenzoate |
| SMILES | CCOc1ccccc1-c1noc(COC(=O)c2cc([N+](=O)[O-])ccc2N(CC)CC)n1 |
| InChI | InChI=1S/C22H24N4O6/c1-4-25(5-2)18-12-11-15(26(28)29)13-17(18)22(27)31-14-20-23-21(24-32-20)16-9-7-8-10-19(16)30-6-3/h7-13H,4-6,14H2,1-3H3 |
| InChIKey | GPFOXRSXTMDLCC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 120.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|