C19H19FN2O3S2 — CID 18269676
butyl 2-[[5-(4-fluorophenyl)-6-methyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetate (PubChem CID 18269676) has the molecular formula C19H19FN2O3S2 and a molecular weight of 406.50 g/mol. Its IUPAC name is butyl 2-[[5-(4-fluorophenyl)-6-methyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetate.
| Compound Name | butyl 2-[[5-(4-fluorophenyl)-6-methyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 18269676 |
| Molecular Formula | C19H19FN2O3S2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | butyl 2-[[5-(4-fluorophenyl)-6-methyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetate |
| SMILES | CCCCOC(=O)CSc1nc2sc(C)c(-c3ccc(F)cc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H19FN2O3S2/c1-3-4-9-25-14(23)10-26-19-21-17(24)16-15(11(2)27-18(16)22-19)12-5-7-13(20)8-6-12/h5-8H,3-4,9-10H2,1-2H3,(H,21,22,24) |
| InChIKey | QSPOOYTXBDIWLE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|