C20H22ClN3O4S — CID 18270213
2-[(E)-(4-chlorophenyl)methylideneamino]oxy-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 18270213) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is 2-[(E)-(4-chlorophenyl)methylideneamino]oxy-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(E)-(4-chlorophenyl)methylideneamino]oxy-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 18270213 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-[(E)-(4-chlorophenyl)methylideneamino]oxy-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CO/N=C/c1ccc(Cl)cc1)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H22ClN3O4S/c21-17-9-7-16(8-10-17)14-22-28-15-20(25)23-18-5-4-6-19(13-18)29(26,27)24-11-2-1-3-12-24/h4-10,13-14H,1-3,11-12,15H2,(H,23,25)/b22-14+ |
| InChIKey | NIPWCTJPCHJCKO-HYARGMPZSA-N |
| XLogP | 3.50 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|