C22H22F4N2O — CID 18270574
(E)-1-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 18270574) has the molecular formula C22H22F4N2O and a molecular weight of 406.42 g/mol. Its IUPAC name is (E)-1-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18270574 |
| Molecular Formula | C22H22F4N2O |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (E)-1-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | CCN1CCN(c2ccc(C(=O)/C=C/c3cccc(C(F)(F)F)c3)cc2F)CC1 |
| InChI | InChI=1S/C22H22F4N2O/c1-2-27-10-12-28(13-11-27)20-8-7-17(15-19(20)23)21(29)9-6-16-4-3-5-18(14-16)22(24,25)26/h3-9,14-15H,2,10-13H2,1H3/b9-6+ |
| InChIKey | DUZBNQNVYROTOI-RMKNXTFCSA-N |
| XLogP | 4.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|