C21H25FN2O2 — CID 52518090
1-[3-fluoro-4-[4-[(2S)-2-hydroxy-2-phenylpropyl]piperazin-1-yl]phenyl]ethanone (PubChem CID 52518090) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-[(2S)-2-hydroxy-2-phenylpropyl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-[4-[(2S)-2-hydroxy-2-phenylpropyl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 52518090 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-[3-fluoro-4-[4-[(2S)-2-hydroxy-2-phenylpropyl]piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C[C@@](C)(O)c3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H25FN2O2/c1-16(25)17-8-9-20(19(22)14-17)24-12-10-23(11-13-24)15-21(2,26)18-6-4-3-5-7-18/h3-9,14,26H,10-13,15H2,1-2H3/t21-/m1/s1 |
| InChIKey | LOFRVIQLYYHREE-OAQYLSRUSA-N |
| XLogP | 3.06 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |