C18H16N4O2S3 — CID 18270821
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanamide (PubChem CID 18270821) has the molecular formula C18H16N4O2S3 and a molecular weight of 416.55 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 18270821 |
| Molecular Formula | C18H16N4O2S3 |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanamide |
| SMILES | N#Cc1c(NC(=O)CCSc2nnc(-c3cccs3)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C18H16N4O2S3/c19-10-12-11-4-1-2-5-13(11)27-17(12)20-15(23)7-9-26-18-22-21-16(24-18)14-6-3-8-25-14/h3,6,8H,1-2,4-5,7,9H2,(H,20,23) |
| InChIKey | GKIARYPEDRXVEZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |