C17H16Cl4N2O2 — CID 18270916
N-(5-tert-butyl-2-methoxyphenyl)-3,4,5,6-tetrachloropyridine-2-carboxamide (PubChem CID 18270916) has the molecular formula C17H16Cl4N2O2 and a molecular weight of 422.14 g/mol. Its IUPAC name is N-(5-tert-butyl-2-methoxyphenyl)-3,4,5,6-tetrachloropyridine-2-carboxamide.
| Compound Name | N-(5-tert-butyl-2-methoxyphenyl)-3,4,5,6-tetrachloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 18270916 |
| Molecular Formula | C17H16Cl4N2O2 |
| Molecular Weight | 422.14 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | N-(5-tert-butyl-2-methoxyphenyl)-3,4,5,6-tetrachloropyridine-2-carboxamide |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)c1nc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl4N2O2/c1-17(2,3)8-5-6-10(25-4)9(7-8)22-16(24)14-12(19)11(18)13(20)15(21)23-14/h5-7H,1-4H3,(H,22,24) |
| InChIKey | AAHLMJPLEPAKLH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.14 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|