C19H22N2O3S — CID 18271747
(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(2-sulfanylidene-1H-pyridin-3-yl)methanone (PubChem CID 18271747) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is (6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(2-sulfanylidene-1H-pyridin-3-yl)methanone.
| Compound Name | (6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(2-sulfanylidene-1H-pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 18271747 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(2-sulfanylidene-1H-pyridin-3-yl)methanone |
| SMILES | CCOc1cc2c(cc1OCC)CN(C(=O)c1ccc[nH]c1=S)CC2 |
| InChI | InChI=1S/C19H22N2O3S/c1-3-23-16-10-13-7-9-21(12-14(13)11-17(16)24-4-2)19(22)15-6-5-8-20-18(15)25/h5-6,8,10-11H,3-4,7,9,12H2,1-2H3,(H,20,25) |
| InChIKey | PGEFMCCSQFBNEZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|