C23H25N3O4S — CID 24550582
7-(6,7-diethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-methyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 24550582) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 7-(6,7-diethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-methyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-(6,7-diethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 24550582 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 7-(6,7-diethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCOc1cc2c(cc1OCC)CN(C(=O)c1ccc3c(=O)n(C)c(=S)[nH]c3c1)CC2 |
| InChI | InChI=1S/C23H25N3O4S/c1-4-29-19-11-14-8-9-26(13-16(14)12-20(19)30-5-2)21(27)15-6-7-17-18(10-15)24-23(31)25(3)22(17)28/h6-7,10-12H,4-5,8-9,13H2,1-3H3,(H,24,31) |
| InChIKey | MFKSFHFCLCSRAC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|