C18H15N3O2S — CID 31921305
7-(2,3-dihydroindole-1-carbonyl)-3-methyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 31921305) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 7-(2,3-dihydroindole-1-carbonyl)-3-methyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-(2,3-dihydroindole-1-carbonyl)-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 31921305 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 7-(2,3-dihydroindole-1-carbonyl)-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | Cn1c(=S)[nH]c2cc(C(=O)N3CCc4ccccc43)ccc2c1=O |
| InChI | InChI=1S/C18H15N3O2S/c1-20-17(23)13-7-6-12(10-14(13)19-18(20)24)16(22)21-9-8-11-4-2-3-5-15(11)21/h2-7,10H,8-9H2,1H3,(H,19,24) |
| InChIKey | IREZQTPEEYQLEN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|