C16H12N2O3 — CID 110766380
6-(2,3-dihydroindole-1-carbonyl)-3H-1,3-benzoxazol-2-one (PubChem CID 110766380) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 6-(2,3-dihydroindole-1-carbonyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(2,3-dihydroindole-1-carbonyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110766380 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6-(2,3-dihydroindole-1-carbonyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccc2[nH]c(=O)oc2c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H12N2O3/c19-15(18-8-7-10-3-1-2-4-13(10)18)11-5-6-12-14(9-11)21-16(20)17-12/h1-6,9H,7-8H2,(H,17,20) |
| InChIKey | SPJDPBOITOKOBU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |