C20H19N3O2S — CID 51339858
7-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 51339858) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 7-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 51339858 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 7-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCn1c(=S)[nH]c2cc(C(=O)N3CCCc4ccccc43)ccc2c1=O |
| InChI | InChI=1S/C20H19N3O2S/c1-2-22-19(25)15-10-9-14(12-16(15)21-20(22)26)18(24)23-11-5-7-13-6-3-4-8-17(13)23/h3-4,6,8-10,12H,2,5,7,11H2,1H3,(H,21,26) |
| InChIKey | NZLYISMHYYILLM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|