C22H23FN4O3S — CID 24548099
7-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1-carbonyl]-3-methyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 24548099) has the molecular formula C22H23FN4O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is 7-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1-carbonyl]-3-methyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1-carbonyl]-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 24548099 |
| Molecular Formula | C22H23FN4O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 7-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1-carbonyl]-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COc1ccc(CN2CCN(C(=O)c3ccc4c(=O)n(C)c(=S)[nH]c4c3)CC2)cc1F |
| InChI | InChI=1S/C22H23FN4O3S/c1-25-21(29)16-5-4-15(12-18(16)24-22(25)31)20(28)27-9-7-26(8-10-27)13-14-3-6-19(30-2)17(23)11-14/h3-6,11-12H,7-10,13H2,1-2H3,(H,24,31) |
| InChIKey | DLLRNJLNWVHLSW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|