C28H29N5O2S — CID 60510941
N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 60510941) has the molecular formula C28H29N5O2S and a molecular weight of 499.64 g/mol. Its IUPAC name is N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 60510941 |
| Molecular Formula | C28H29N5O2S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | Cn1c(=S)[nH]c2cc(C(=O)Nc3ccc(CN4CCN(Cc5ccccc5)CC4)cc3)ccc2c1=O |
| InChI | InChI=1S/C28H29N5O2S/c1-31-27(35)24-12-9-22(17-25(24)30-28(31)36)26(34)29-23-10-7-21(8-11-23)19-33-15-13-32(14-16-33)18-20-5-3-2-4-6-20/h2-12,17H,13-16,18-19H2,1H3,(H,29,34)(H,30,36) |
| InChIKey | MTCMPESLUABZNC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|