C19H19N5O2S — CID 30268622
3-methyl-4-oxo-N-(6-pyrrolidin-1-yl-3-pyridinyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 30268622) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-methyl-4-oxo-N-(6-pyrrolidin-1-yl-3-pyridinyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-methyl-4-oxo-N-(6-pyrrolidin-1-yl-3-pyridinyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 30268622 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-methyl-4-oxo-N-(6-pyrrolidin-1-yl-3-pyridinyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | Cn1c(=S)[nH]c2cc(C(=O)Nc3ccc(N4CCCC4)nc3)ccc2c1=O |
| InChI | InChI=1S/C19H19N5O2S/c1-23-18(26)14-6-4-12(10-15(14)22-19(23)27)17(25)21-13-5-7-16(20-11-13)24-8-2-3-9-24/h4-7,10-11H,2-3,8-9H2,1H3,(H,21,25)(H,22,27) |
| InChIKey | WTFMVHYQGUKKDB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|