C22H23F3N2O3 — CID 18272429
1-(4-ethoxyphenyl)-5-oxo-N-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine-3-carboxamide (PubChem CID 18272429) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-5-oxo-N-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-ethoxyphenyl)-5-oxo-N-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 18272429 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-(4-ethoxyphenyl)-5-oxo-N-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine-3-carboxamide |
| SMILES | CCOc1ccc(N2CC(C(=O)NCCc3ccc(C(F)(F)F)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C22H23F3N2O3/c1-2-30-19-9-7-18(8-10-19)27-14-16(13-20(27)28)21(29)26-12-11-15-3-5-17(6-4-15)22(23,24)25/h3-10,16H,2,11-14H2,1H3,(H,26,29) |
| InChIKey | CHRAJPWUYXMSJZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |