C23H28N2O3 — CID 7325487
(3R)-1-(4-butoxyphenyl)-5-oxo-N-(2-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 7325487) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is (3R)-1-(4-butoxyphenyl)-5-oxo-N-(2-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-butoxyphenyl)-5-oxo-N-(2-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7325487 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (3R)-1-(4-butoxyphenyl)-5-oxo-N-(2-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCOc1ccc(N2C[C@H](C(=O)NCCc3ccccc3)CC2=O)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-2-3-15-28-21-11-9-20(10-12-21)25-17-19(16-22(25)26)23(27)24-14-13-18-7-5-4-6-8-18/h4-12,19H,2-3,13-17H2,1H3,(H,24,27)/t19-/m1/s1 |
| InChIKey | FNBVWJIVMQYBSC-LJQANCHMSA-N |
| XLogP | 3.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|