C19H14ClF3N2O3 — CID 18272683
(4-chlorophenyl)methyl 4-methoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate (PubChem CID 18272683) has the molecular formula C19H14ClF3N2O3 and a molecular weight of 410.78 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-methoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 4-methoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 18272683 |
| Molecular Formula | C19H14ClF3N2O3 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (4-chlorophenyl)methyl 4-methoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate |
| SMILES | COc1cn(-c2cccc(C(F)(F)F)c2)nc1C(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClF3N2O3/c1-27-16-10-25(15-4-2-3-13(9-15)19(21,22)23)24-17(16)18(26)28-11-12-5-7-14(20)8-6-12/h2-10H,11H2,1H3 |
| InChIKey | KYGBHXUTIHOELO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |