C16H19N5O4S — CID 18274312
(3-aminopyrazin-2-yl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 18274312) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 18274312 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3nccnc3N)CC2)cc1 |
| InChI | InChI=1S/C16H19N5O4S/c1-25-12-2-4-13(5-3-12)26(23,24)21-10-8-20(9-11-21)16(22)14-15(17)19-7-6-18-14/h2-7H,8-11H2,1H3,(H2,17,19) |
| InChIKey | LDGFZVNUWLYBNH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |