C15H16BrN5O3S — CID 16594148
(3-aminopyrazin-2-yl)-[4-(2-bromophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 16594148) has the molecular formula C15H16BrN5O3S and a molecular weight of 426.30 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[4-(2-bromophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[4-(2-bromophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 16594148 |
| Molecular Formula | C15H16BrN5O3S |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[4-(2-bromophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Nc1nccnc1C(=O)N1CCN(S(=O)(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C15H16BrN5O3S/c16-11-3-1-2-4-12(11)25(23,24)21-9-7-20(8-10-21)15(22)13-14(17)19-6-5-18-13/h1-6H,7-10H2,(H2,17,19) |
| InChIKey | RZPARLQFDDLZDP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |