C21H16N2O7S — CID 18279088
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate (PubChem CID 18279088) has the molecular formula C21H16N2O7S and a molecular weight of 440.43 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 18279088 |
| Molecular Formula | C21H16N2O7S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4H-thieno[3,2-c]chromene-2-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C21H16N2O7S/c1-28-17-9-13(23(26)27)6-7-15(17)22-19(24)11-30-21(25)18-8-12-10-29-16-5-3-2-4-14(16)20(12)31-18/h2-9H,10-11H2,1H3,(H,22,24) |
| InChIKey | CVIQKDXNARPDLP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|