C18H18BrN3O2S — CID 18281706
3-[2-(4-bromophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole (PubChem CID 18281706) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is 3-[2-(4-bromophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole.
| Compound Name | 3-[2-(4-bromophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 18281706 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 3-[2-(4-bromophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole |
| SMILES | COc1ccc(-c2nnc(SCCOc3ccc(Br)cc3)n2C)cc1 |
| InChI | InChI=1S/C18H18BrN3O2S/c1-22-17(13-3-7-15(23-2)8-4-13)20-21-18(22)25-12-11-24-16-9-5-14(19)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | NBVRILDVJQXUOD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|