C18H13ClF3NO2S — CID 18282798
3-chloro-4-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 18282798) has the molecular formula C18H13ClF3NO2S and a molecular weight of 399.82 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-4-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18282798 |
| Molecular Formula | C18H13ClF3NO2S |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 3-chloro-4-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cccc2sc(C(=O)NCc3ccc(OC(F)(F)F)cc3)c(Cl)c12 |
| InChI | InChI=1S/C18H13ClF3NO2S/c1-10-3-2-4-13-14(10)15(19)16(26-13)17(24)23-9-11-5-7-12(8-6-11)25-18(20,21)22/h2-8H,9H2,1H3,(H,23,24) |
| InChIKey | HPGQIHLUDPLLND-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |