C20H14FN3O2S — CID 18283992
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 4-pyrazol-1-ylbenzoate (PubChem CID 18283992) has the molecular formula C20H14FN3O2S and a molecular weight of 379.42 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 4-pyrazol-1-ylbenzoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 4-pyrazol-1-ylbenzoate |
|---|---|
| PubChem CID | 18283992 |
| Molecular Formula | C20H14FN3O2S |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 4-pyrazol-1-ylbenzoate |
| SMILES | O=C(OCc1csc(-c2ccc(F)cc2)n1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C20H14FN3O2S/c21-16-6-2-14(3-7-16)19-23-17(13-27-19)12-26-20(25)15-4-8-18(9-5-15)24-11-1-10-22-24/h1-11,13H,12H2 |
| InChIKey | BVOHSPDSPRYNHG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |