C26H19NO4 — CID 18284156
[2-(9H-fluoren-3-yl)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 18284156) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18284156 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)OCC(=O)c2ccc3c(c2)-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C26H19NO4/c1-30-22-10-6-17(7-11-22)12-21(15-27)26(29)31-16-25(28)20-9-8-19-13-18-4-2-3-5-23(18)24(19)14-20/h2-12,14H,13,16H2,1H3/b21-12+ |
| InChIKey | UVXUORGSOLRHHX-CIAFOILYSA-N |
| XLogP | 4.60 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|