C21H21N5O2S2 — CID 18287292
2-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 18287292) has the molecular formula C21H21N5O2S2 and a molecular weight of 439.57 g/mol. Its IUPAC name is 2-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18287292 |
| Molecular Formula | C21H21N5O2S2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(-c2noc(CSc3nc(N)c4c5c(sc4n3)CC(C)CC5)n2)cc1 |
| InChI | InChI=1S/C21H21N5O2S2/c1-11-3-8-14-15(9-11)30-20-17(14)18(22)24-21(25-20)29-10-16-23-19(26-28-16)12-4-6-13(27-2)7-5-12/h4-7,11H,3,8-10H2,1-2H3,(H2,22,24,25) |
| InChIKey | HLCMXIMWXLCSSM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |