C19H19N5O2S2 — CID 36982021
(7S)-2-[(1R)-1-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]sulfanyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 36982021) has the molecular formula C19H19N5O2S2 and a molecular weight of 413.53 g/mol. Its IUPAC name is (7S)-2-[(1R)-1-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]sulfanyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (7S)-2-[(1R)-1-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]sulfanyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 36982021 |
| Molecular Formula | C19H19N5O2S2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (7S)-2-[(1R)-1-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]sulfanyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@H]1CCc2c(sc3nc(S[C@H](C)c4nc(-c5ccco5)no4)nc(N)c23)C1 |
| InChI | InChI=1S/C19H19N5O2S2/c1-9-5-6-11-13(8-9)28-18-14(11)15(20)21-19(23-18)27-10(2)17-22-16(24-26-17)12-4-3-7-25-12/h3-4,7,9-10H,5-6,8H2,1-2H3,(H2,20,21,23)/t9-,10+/m0/s1 |
| InChIKey | RNZJMOQIESFELM-VHSXEESVSA-N |
| XLogP | 4.89 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |