C20H20N2O3S — CID 18287759
ethyl 4-cyclopropyl-2-[[2-(1H-indol-3-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 18287759) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is ethyl 4-cyclopropyl-2-[[2-(1H-indol-3-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-cyclopropyl-2-[[2-(1H-indol-3-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18287759 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | ethyl 4-cyclopropyl-2-[[2-(1H-indol-3-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N2O3S/c1-2-25-20(24)18-15(12-7-8-12)11-26-19(18)22-17(23)9-13-10-21-16-6-4-3-5-14(13)16/h3-6,10-12,21H,2,7-9H2,1H3,(H,22,23) |
| InChIKey | KCMOLKKJMVGBOY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |