About [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate
[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate (PubChem CID 18293054) has the molecular formula C20H15ClN2O4S
and a molecular weight of 414.87 g/mol. Its IUPAC name is [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate |
| PubChem CID | 18293054 |
| Molecular Formula | C20H15ClN2O4S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate |
| SMILES | Cc1ccc2nc(NC(=O)COC(=O)C3=Cc4cc(Cl)ccc4OC3)sc2c1 |
| InChI | InChI=1S/C20H15ClN2O4S/c1-11-2-4-15-17(6-11)28-20(22-15)23-18(24)10-27-19(25)13-7-12-8-14(21)3-5-16(12)26-9-13/h2-8H,9-10H2,1H3,(H,22,23,24) |
| InChIKey | CAGPKRNBDXGONA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate?
The IUPAC name of [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate (CID 18293054) is [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate.
What is the SMILES notation for [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate?
The canonical SMILES for [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate is Cc1ccc2nc(NC(=O)COC(=O)C3=Cc4cc(Cl)ccc4OC3)sc2c1.
What is the InChIKey of [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate?
The InChIKey is CAGPKRNBDXGONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN2O4S/c1-11-2-4-15-17(6-11)28-20(22-15)23-18(24)10-27-19(25)13-7-12-8-14(21)3-5-16(12)26-9-13/h2-8H,9-10H2,1H3,(H,22,23,24).
What are the key properties of [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate?
[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate has a molecular weight of 414.87 g/mol, XLogP of 4.22, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate is sourced from PubChem (CID 18293054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).