C19H12Cl2F3NO4 — CID 55443891
[2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate (PubChem CID 55443891) has the molecular formula C19H12Cl2F3NO4 and a molecular weight of 446.21 g/mol. Its IUPAC name is [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate.
| Compound Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 55443891 |
| Molecular Formula | C19H12Cl2F3NO4 |
| Molecular Weight | 446.21 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate |
| SMILES | O=C(COC(=O)C1=Cc2cc(Cl)ccc2OC1)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C19H12Cl2F3NO4/c20-12-4-5-15-10(7-12)6-11(8-28-15)18(27)29-9-16(26)25-17-13(19(22,23)24)2-1-3-14(17)21/h1-7H,8-9H2,(H,25,26) |
| InChIKey | DFZHNWOHWBSJSM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.21 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |