C20H15ClF3NO4 — CID 46641408
[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 6-chloro-2H-chromene-3-carboxylate (PubChem CID 46641408) has the molecular formula C20H15ClF3NO4 and a molecular weight of 425.79 g/mol. Its IUPAC name is [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 6-chloro-2H-chromene-3-carboxylate.
| Compound Name | [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 6-chloro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 46641408 |
| Molecular Formula | C20H15ClF3NO4 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 6-chloro-2H-chromene-3-carboxylate |
| SMILES | CC(OC(=O)C1=Cc2cc(Cl)ccc2OC1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H15ClF3NO4/c1-11(18(26)25-16-5-3-2-4-15(16)20(22,23)24)29-19(27)13-8-12-9-14(21)6-7-17(12)28-10-13/h2-9,11H,10H2,1H3,(H,25,26) |
| InChIKey | OLEXYWFEXBEXHX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |