C16H16ClNO4 — CID 40754288
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 6-chloro-2H-chromene-3-carboxylate (PubChem CID 40754288) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 6-chloro-2H-chromene-3-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 6-chloro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 40754288 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 6-chloro-2H-chromene-3-carboxylate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C16H16ClNO4/c1-3-6-18-15(19)10(2)22-16(20)12-7-11-8-13(17)4-5-14(11)21-9-12/h3-5,7-8,10H,1,6,9H2,2H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | RZCDVOUYCRWVFH-JTQLQIEISA-N |
| XLogP | 2.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|