C17H19ClN2O5 — CID 46641315
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate (PubChem CID 46641315) has the molecular formula C17H19ClN2O5 and a molecular weight of 366.80 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 46641315 |
| Molecular Formula | C17H19ClN2O5 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C17H19ClN2O5/c1-10(2)7-19-17(23)20-15(21)9-25-16(22)12-5-11-6-13(18)3-4-14(11)24-8-12/h3-6,10H,7-9H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | LPZZDRMVSCJHLX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |