C16H17ClN2O6 — CID 46641415
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate (PubChem CID 46641415) has the molecular formula C16H17ClN2O6 and a molecular weight of 368.77 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 46641415 |
| Molecular Formula | C16H17ClN2O6 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 6-chloro-2H-chromene-3-carboxylate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C16H17ClN2O6/c1-23-5-4-18-16(22)19-14(20)9-25-15(21)11-6-10-7-12(17)2-3-13(10)24-8-11/h2-3,6-7H,4-5,8-9H2,1H3,(H2,18,19,20,22) |
| InChIKey | CPAHXUHRPIRYCI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|