C24H36N6O8 — CID 18293867
2-[[4-amino-2-[[5-amino-2-[(2-amino-3-methylpentanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18293867) has the molecular formula C24H36N6O8 and a molecular weight of 536.59 g/mol. Its IUPAC name is 2-[[4-amino-2-[[5-amino-2-[(2-amino-3-methylpentanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[4-amino-2-[[5-amino-2-[(2-amino-3-methylpentanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18293867 |
| Molecular Formula | C24H36N6O8 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 2-[[4-amino-2-[[5-amino-2-[(2-amino-3-methylpentanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H36N6O8/c1-3-12(2)20(27)23(36)28-15(8-9-18(25)32)21(34)29-16(11-19(26)33)22(35)30-17(24(37)38)10-13-4-6-14(31)7-5-13/h4-7,12,15-17,20,31H,3,8-11,27H2,1-2H3,(H2,25,32)(H2,26,33)(H,28,36)(H,29,34)(H,30,35)(H,37,38) |
| InChIKey | AVMRCNYZQDOHAH-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |