C24H36N6O7 — CID 18296721
4-amino-2-[[5-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18296721) has the molecular formula C24H36N6O7 and a molecular weight of 520.59 g/mol. Its IUPAC name is 4-amino-2-[[5-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[5-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18296721 |
| Molecular Formula | C24H36N6O7 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 4-amino-2-[[5-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H36N6O7/c1-3-13(2)20(27)23(35)29-16(11-14-7-5-4-6-8-14)22(34)28-15(9-10-18(25)31)21(33)30-17(24(36)37)12-19(26)32/h4-8,13,15-17,20H,3,9-12,27H2,1-2H3,(H2,25,31)(H2,26,32)(H,28,34)(H,29,35)(H,30,33)(H,36,37) |
| InChIKey | GQQLJXLIDATRDL-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 236.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |