C21H37N9O5 — CID 18294625
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid (PubChem CID 18294625) has the molecular formula C21H37N9O5 and a molecular weight of 495.59 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18294625 |
| Molecular Formula | C21H37N9O5 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C21H37N9O5/c1-4-11(2)16(22)19(33)30-15(8-13-9-25-10-27-13)18(32)29-14(6-5-7-26-21(23)24)17(31)28-12(3)20(34)35/h9-12,14-16H,4-8,22H2,1-3H3,(H,25,27)(H,28,31)(H,29,32)(H,30,33)(H,34,35)(H4,23,24,26) |
| InChIKey | VPIYFSBJJUICGK-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|