C20H34N10O6 — CID 18479978
2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanoyl]amino]propanoic acid (PubChem CID 18479978) has the molecular formula C20H34N10O6 and a molecular weight of 510.56 g/mol. Its IUPAC name is 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanoyl]amino]propanoic acid.
| Compound Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18479978 |
| Molecular Formula | C20H34N10O6 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H34N10O6/c1-10(19(35)36)28-17(33)13(3-2-6-26-20(23)24)29-18(34)14(7-11-8-25-9-27-11)30-16(32)12(21)4-5-15(22)31/h8-10,12-14H,2-7,21H2,1H3,(H2,22,31)(H,25,27)(H,28,33)(H,29,34)(H,30,32)(H,35,36)(H4,23,24,26) |
| InChIKey | IRMZOKXXFCSAGV-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 286.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|