C19H30N6O8 — CID 18294907
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 18294907) has the molecular formula C19H30N6O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18294907 |
| Molecular Formula | C19H30N6O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H30N6O8/c1-3-9(2)15(20)18(31)23-11(4-10-6-21-8-22-10)16(29)25-13(7-26)17(30)24-12(19(32)33)5-14(27)28/h6,8-9,11-13,15,26H,3-5,7,20H2,1-2H3,(H,21,22)(H,23,31)(H,24,30)(H,25,29)(H,27,28)(H,32,33) |
| InChIKey | UPYHPVRIGXJWAQ-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 236.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |