C16H24N6O8 — CID 18238693
2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid (PubChem CID 18238693) has the molecular formula C16H24N6O8 and a molecular weight of 428.40 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18238693 |
| Molecular Formula | C16H24N6O8 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
| SMILES | CC(N)C(=O)NC(CO)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24N6O8/c1-7(17)13(26)22-11(5-23)15(28)20-9(2-8-4-18-6-19-8)14(27)21-10(16(29)30)3-12(24)25/h4,6-7,9-11,23H,2-3,5,17H2,1H3,(H,18,19)(H,20,28)(H,21,27)(H,22,26)(H,24,25)(H,29,30) |
| InChIKey | YXRQOKSBTONKIJ-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 236.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |