C16H25N7O7 — CID 18233549
2-[[2-[[4-amino-2-(2-aminopropanoylamino)-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18233549) has the molecular formula C16H25N7O7 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-(2-aminopropanoylamino)-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-(2-aminopropanoylamino)-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18233549 |
| Molecular Formula | C16H25N7O7 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[[2-[[4-amino-2-(2-aminopropanoylamino)-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(N)C(=O)NC(CC(N)=O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C16H25N7O7/c1-7(17)13(26)21-10(3-12(18)25)15(28)22-9(2-8-4-19-6-20-8)14(27)23-11(5-24)16(29)30/h4,6-7,9-11,24H,2-3,5,17H2,1H3,(H2,18,25)(H,19,20)(H,21,26)(H,22,28)(H,23,27)(H,29,30) |
| InChIKey | MAAGPVVIKNCKAA-UHFFFAOYSA-N |
| XLogP | -4.29 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |