C26H36N6O7 — CID 18296707
4-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid (PubChem CID 18296707) has the molecular formula C26H36N6O7 and a molecular weight of 544.61 g/mol. Its IUPAC name is 4-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18296707 |
| Molecular Formula | C26H36N6O7 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 4-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C26H36N6O7/c1-3-15(2)22(27)25(37)31-19(11-16-7-5-4-6-8-16)24(36)30-18(9-10-21(33)34)23(35)32-20(26(38)39)12-17-13-28-14-29-17/h4-8,13-15,18-20,22H,3,9-12,27H2,1-2H3,(H,28,29)(H,30,36)(H,31,37)(H,32,35)(H,33,34)(H,38,39) |
| InChIKey | KJHXDTFQBUKIEB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 216.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |