C24H34N6O5S — CID 18502375
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18502375) has the molecular formula C24H34N6O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18502375 |
| Molecular Formula | C24H34N6O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H34N6O5S/c1-3-14(2)20(25)23(33)30-19(12-36)22(32)28-17(10-16-11-26-13-27-16)21(31)29-18(24(34)35)9-15-7-5-4-6-8-15/h4-8,11,13-14,17-20,36H,3,9-10,12,25H2,1-2H3,(H,26,27)(H,28,32)(H,29,31)(H,30,33)(H,34,35) |
| InChIKey | JDSYGQHQCCRGGX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 179.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|