C21H39N7O6 — CID 18301013
2-[[1-[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18301013) has the molecular formula C21H39N7O6 and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-[[1-[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[1-[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18301013 |
| Molecular Formula | C21H39N7O6 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 2-[[1-[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)O |
| InChI | InChI=1S/C21H39N7O6/c1-11(2)10-13(22)17(30)27-16(12(3)29)19(32)28-9-5-7-15(28)18(31)26-14(20(33)34)6-4-8-25-21(23)24/h11-16,29H,4-10,22H2,1-3H3,(H,26,31)(H,27,30)(H,33,34)(H4,23,24,25) |
| InChIKey | UTJOWFYZQJFDGN-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|