C15H29N5O5S — CID 18305320
2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-methylsulfanylbutanoyl]amino]acetic acid (PubChem CID 18305320) has the molecular formula C15H29N5O5S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-methylsulfanylbutanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-methylsulfanylbutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18305320 |
| Molecular Formula | C15H29N5O5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-methylsulfanylbutanoyl]amino]acetic acid |
| SMILES | CSCCC(NC(=O)CNC(=O)C(N)CCCCN)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H29N5O5S/c1-26-7-5-11(15(25)19-9-13(22)23)20-12(21)8-18-14(24)10(17)4-2-3-6-16/h10-11H,2-9,16-17H2,1H3,(H,18,24)(H,19,25)(H,20,21)(H,22,23) |
| InChIKey | PGPOXEMBUXRCAW-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|