C26H36N8O5S — CID 18305568
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18305568) has the molecular formula C26H36N8O5S and a molecular weight of 572.69 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18305568 |
| Molecular Formula | C26H36N8O5S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H36N8O5S/c27-8-4-3-6-18(28)23(35)32-20(10-16-12-29-14-31-16)24(36)34-22(13-40)25(37)33-21(26(38)39)9-15-11-30-19-7-2-1-5-17(15)19/h1-2,5,7,11-12,14,18,20-22,30,40H,3-4,6,8-10,13,27-28H2,(H,29,31)(H,32,35)(H,33,37)(H,34,36)(H,38,39) |
| InChIKey | JTFQXXJRSGMXPX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 221.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|