C25H37N5O8 — CID 18309727
2-[[1-[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 18309727) has the molecular formula C25H37N5O8 and a molecular weight of 535.60 g/mol. Its IUPAC name is 2-[[1-[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[1-[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18309727 |
| Molecular Formula | C25H37N5O8 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 2-[[1-[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H37N5O8/c26-12-2-1-4-17(27)22(34)29-19(14-15-6-8-16(31)9-7-15)24(36)30-13-3-5-20(30)23(35)28-18(25(37)38)10-11-21(32)33/h6-9,17-20,31H,1-5,10-14,26-27H2,(H,28,35)(H,29,34)(H,32,33)(H,37,38) |
| InChIKey | NQNBACZPPCFAGJ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 225.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|