C22H35N7O6S — CID 18313075
2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18313075) has the molecular formula C22H35N7O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18313075 |
| Molecular Formula | C22H35N7O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CSCCC(N)C(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H35N7O6S/c1-36-10-8-15(23)19(32)27-12-18(31)28-16(3-2-9-26-22(24)25)20(33)29-17(21(34)35)11-13-4-6-14(30)7-5-13/h4-7,15-17,30H,2-3,8-12,23H2,1H3,(H,27,32)(H,28,31)(H,29,33)(H,34,35)(H4,24,25,26) |
| InChIKey | PSPUFCFCMQIMMQ-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|